C36H45N2O+ — CID 76691150
6-[2-[5-(3,3-dimethyl-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraen-2-yl)penta-2,4-dienylidene]-3-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-3-yl]hexan-1-ol (PubChem CID 76691150) has the molecular formula C36H45N2O+ and a molecular weight of 521.77 g/mol. Its IUPAC name is 6-[2-[5-(3,3-dimethyl-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraen-2-yl)penta-2,4-dienylidene]-3-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-3-yl]hexan-1-ol.
| Compound Name | 6-[2-[5-(3,3-dimethyl-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraen-2-yl)penta-2,4-dienylidene]-3-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-3-yl]hexan-1-ol |
|---|---|
| PubChem CID | 76691150 |
| Molecular Formula | C36H45N2O+ |
| Molecular Weight | 521.77 g/mol |
| Exact Mass | 521.35 |
| IUPAC Name | 6-[2-[5-(3,3-dimethyl-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraen-2-yl)penta-2,4-dienylidene]-3-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-3-yl]hexan-1-ol |
| SMILES | CC1(C)C(C=CC=CC=C2N3CCCc4cccc(c43)C2(C)CCCCCCO)=[N+]2CCCc3cccc1c32 |
| InChI | InChI=1S/C36H45N2O/c1-35(2)29-19-11-15-27-17-13-24-37(33(27)29)31(35)21-7-6-8-22-32-36(3,23-9-4-5-10-26-39)30-20-12-16-28-18-14-25-38(32)34(28)30/h6-8,11-12,15-16,19-22,39H,4-5,9-10,13-14,17-18,23-26H2,1-3H3/q+1 |
| InChIKey | ABWGFTOWGBDEIO-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.77 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|