About N-(2-hydroxypropyl)nona-2,6-dienamide
N-(2-hydroxypropyl)nona-2,6-dienamide (PubChem CID 76694616) has the molecular formula C12H21NO2
and a molecular weight of 211.31 g/mol. Its IUPAC name is N-(2-hydroxypropyl)nona-2,6-dienamide.
Molecular Properties
| Compound Name | N-(2-hydroxypropyl)nona-2,6-dienamide |
| PubChem CID | 76694616 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | N-(2-hydroxypropyl)nona-2,6-dienamide |
| SMILES | CCC=CCCC=CC(=O)NCC(C)O |
| InChI | InChI=1S/C12H21NO2/c1-3-4-5-6-7-8-9-12(15)13-10-11(2)14/h4-5,8-9,11,14H,3,6-7,10H2,1-2H3,(H,13,15) |
| InChIKey | DGRJKPLVQOBFQX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2-hydroxypropyl)nona-2,6-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxypropyl)nona-2,6-dienamide?
The IUPAC name of N-(2-hydroxypropyl)nona-2,6-dienamide (CID 76694616) is N-(2-hydroxypropyl)nona-2,6-dienamide.
What is the SMILES notation for N-(2-hydroxypropyl)nona-2,6-dienamide?
The canonical SMILES for N-(2-hydroxypropyl)nona-2,6-dienamide is CCC=CCCC=CC(=O)NCC(C)O.
What is the InChIKey of N-(2-hydroxypropyl)nona-2,6-dienamide?
The InChIKey is DGRJKPLVQOBFQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO2/c1-3-4-5-6-7-8-9-12(15)13-10-11(2)14/h4-5,8-9,11,14H,3,6-7,10H2,1-2H3,(H,13,15).
What are the key properties of N-(2-hydroxypropyl)nona-2,6-dienamide?
N-(2-hydroxypropyl)nona-2,6-dienamide has a molecular weight of 211.31 g/mol, XLogP of 1.79, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxypropyl)nona-2,6-dienamide is sourced from PubChem (CID 76694616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).