C25H29N4+ — CID 76699744
N-methyl-N-[1-(1-methylquinolin-1-ium-4-yl)ethylideneamino]-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-amine (PubChem CID 76699744) has the molecular formula C25H29N4+ and a molecular weight of 385.54 g/mol. Its IUPAC name is N-methyl-N-[1-(1-methylquinolin-1-ium-4-yl)ethylideneamino]-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-amine.
| Compound Name | N-methyl-N-[1-(1-methylquinolin-1-ium-4-yl)ethylideneamino]-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-amine |
|---|---|
| PubChem CID | 76699744 |
| Molecular Formula | C25H29N4+ |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | N-methyl-N-[1-(1-methylquinolin-1-ium-4-yl)ethylideneamino]-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-amine |
| SMILES | CC(=NN(C)c1cc2c3c(c1)CCCN3CCC2)c1cc[n+](C)c2ccccc12 |
| InChI | InChI=1S/C25H29N4/c1-18(22-12-15-27(2)24-11-5-4-10-23(22)24)26-28(3)21-16-19-8-6-13-29-14-7-9-20(17-21)25(19)29/h4-5,10-12,15-17H,6-9,13-14H2,1-3H3/q+1 |
| InChIKey | YCRYPKFAJDAHDZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 22.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|