C13H19NOS — CID 767000
(5S)-5-methylspiro[1,3-thiazolidine-2,2'-adamantane]-4-one (PubChem CID 767000) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is (5S)-5-methylspiro[1,3-thiazolidine-2,2'-adamantane]-4-one.
| Compound Name | (5S)-5-methylspiro[1,3-thiazolidine-2,2'-adamantane]-4-one |
|---|---|
| PubChem CID | 767000 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (5S)-5-methylspiro[1,3-thiazolidine-2,2'-adamantane]-4-one |
| SMILES | C[C@@H]1SC2(NC1=O)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C13H19NOS/c1-7-12(15)14-13(16-7)10-3-8-2-9(5-10)6-11(13)4-8/h7-11H,2-6H2,1H3,(H,14,15)/t7-,8?,9?,10?,11?,13?/m0/s1 |
| InChIKey | GJBVZWMAFHSDEV-UJPKHONOSA-N |
| XLogP | 2.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |