C29H29F3N2O2 — CID 76703388
N-[2-cyano-4-(trifluoromethyl)phenyl]-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenamide (PubChem CID 76703388) has the molecular formula C29H29F3N2O2 and a molecular weight of 494.56 g/mol. Its IUPAC name is N-[2-cyano-4-(trifluoromethyl)phenyl]-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenamide.
| Compound Name | N-[2-cyano-4-(trifluoromethyl)phenyl]-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 76703388 |
| Molecular Formula | C29H29F3N2O2 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | N-[2-cyano-4-(trifluoromethyl)phenyl]-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenamide |
| SMILES | COc1cc(C)c(C=CC(C)=CC=CC(C)=CC(=O)Nc2ccc(C(F)(F)F)cc2C#N)c(C)c1C |
| InChI | InChI=1S/C29H29F3N2O2/c1-18(10-12-25-20(3)15-27(36-6)22(5)21(25)4)8-7-9-19(2)14-28(35)34-26-13-11-24(29(30,31)32)16-23(26)17-33/h7-16H,1-6H3,(H,34,35) |
| InChIKey | NJQWOEOJJAMNMB-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|