C10H14N4O — CID 76705563
5-amino-1-(3-methyloxan-4-yl)pyrazole-4-carbonitrile (PubChem CID 76705563) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is 5-amino-1-(3-methyloxan-4-yl)pyrazole-4-carbonitrile.
| Compound Name | 5-amino-1-(3-methyloxan-4-yl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 76705563 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 5-amino-1-(3-methyloxan-4-yl)pyrazole-4-carbonitrile |
| SMILES | CC1COCCC1n1ncc(C#N)c1N |
| InChI | InChI=1S/C10H14N4O/c1-7-6-15-3-2-9(7)14-10(12)8(4-11)5-13-14/h5,7,9H,2-3,6,12H2,1H3 |
| InChIKey | DADQGVSGGANJCE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |