About 3,4-diethyl-1,4-dihydropyrazol-5-one
3,4-diethyl-1,4-dihydropyrazol-5-one (PubChem CID 76707712) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is 3,4-diethyl-1,4-dihydropyrazol-5-one.
Molecular Properties
| Compound Name | 3,4-diethyl-1,4-dihydropyrazol-5-one |
| PubChem CID | 76707712 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 3,4-diethyl-1,4-dihydropyrazol-5-one |
| SMILES | CCC1=NNC(=O)C1CC |
| InChI | InChI=1S/C7H12N2O/c1-3-5-6(4-2)8-9-7(5)10/h5H,3-4H2,1-2H3,(H,9,10) |
| InChIKey | WCKFQUMEALSPBS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-diethyl-1,4-dihydropyrazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diethyl-1,4-dihydropyrazol-5-one?
The IUPAC name of 3,4-diethyl-1,4-dihydropyrazol-5-one (CID 76707712) is 3,4-diethyl-1,4-dihydropyrazol-5-one.
What is the SMILES notation for 3,4-diethyl-1,4-dihydropyrazol-5-one?
The canonical SMILES for 3,4-diethyl-1,4-dihydropyrazol-5-one is CCC1=NNC(=O)C1CC.
What is the InChIKey of 3,4-diethyl-1,4-dihydropyrazol-5-one?
The InChIKey is WCKFQUMEALSPBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O/c1-3-5-6(4-2)8-9-7(5)10/h5H,3-4H2,1-2H3,(H,9,10).
What are the key properties of 3,4-diethyl-1,4-dihydropyrazol-5-one?
3,4-diethyl-1,4-dihydropyrazol-5-one has a molecular weight of 140.19 g/mol, XLogP of 0.91, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diethyl-1,4-dihydropyrazol-5-one is sourced from PubChem (CID 76707712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).