About 1-(4-ethylphenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanone
1-(4-ethylphenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanone (PubChem CID 767111) has the molecular formula C13H14N2OS
and a molecular weight of 246.34 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanone.
Molecular Properties
| Compound Name | 1-(4-ethylphenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanone |
| PubChem CID | 767111 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 1-(4-ethylphenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanone |
| SMILES | [H]/N=c1\sccn1CC(=O)c1ccc(CC)cc1 |
| InChI | InChI=1S/C13H14N2OS/c1-2-10-3-5-11(6-4-10)12(16)9-15-7-8-17-13(15)14/h3-8,14H,2,9H2,1H3/b14-13- |
| InChIKey | MGFAHTMHQRYOMW-YPKPFQOOSA-N |
| XLogP | 2.47 |
| TPSA | 45.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-ethylphenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethylphenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanone?
The IUPAC name of 1-(4-ethylphenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanone (CID 767111) is 1-(4-ethylphenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanone.
What is the SMILES notation for 1-(4-ethylphenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanone?
The canonical SMILES for 1-(4-ethylphenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanone is [H]/N=c1\sccn1CC(=O)c1ccc(CC)cc1.
What is the InChIKey of 1-(4-ethylphenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanone?
The InChIKey is MGFAHTMHQRYOMW-YPKPFQOOSA-N. The full InChI is InChI=1S/C13H14N2OS/c1-2-10-3-5-11(6-4-10)12(16)9-15-7-8-17-13(15)14/h3-8,14H,2,9H2,1H3/b14-13-.
What are the key properties of 1-(4-ethylphenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanone?
1-(4-ethylphenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanone has a molecular weight of 246.34 g/mol, XLogP of 2.47, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethylphenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanone is sourced from PubChem (CID 767111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).