C17H16ClN3O3S — CID 76713224
N'-chloro-5,6-dioxospiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-1'-carboximidamide (PubChem CID 76713224) has the molecular formula C17H16ClN3O3S and a molecular weight of 377.85 g/mol. Its IUPAC name is N'-chloro-5,6-dioxospiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-1'-carboximidamide.
| Compound Name | N'-chloro-5,6-dioxospiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-1'-carboximidamide |
|---|---|
| PubChem CID | 76713224 |
| Molecular Formula | C17H16ClN3O3S |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | N'-chloro-5,6-dioxospiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-1'-carboximidamide |
| SMILES | NC(=NCl)N1CCC2(CC1)CSC1=C(O2)c2ccccc2C(=O)C1=O |
| InChI | InChI=1S/C17H16ClN3O3S/c18-20-16(19)21-7-5-17(6-8-21)9-25-15-13(23)12(22)10-3-1-2-4-11(10)14(15)24-17/h1-4H,5-9H2,(H2,19,20) |
| InChIKey | HIEKQSWFRNJFST-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|