C25H43NO4 — CID 76714948
5-[3-(dioctylamino)prop-2-enylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 76714948) has the molecular formula C25H43NO4 and a molecular weight of 421.62 g/mol. Its IUPAC name is 5-[3-(dioctylamino)prop-2-enylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[3-(dioctylamino)prop-2-enylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 76714948 |
| Molecular Formula | C25H43NO4 |
| Molecular Weight | 421.62 g/mol |
| Exact Mass | 421.32 |
| IUPAC Name | 5-[3-(dioctylamino)prop-2-enylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CCCCCCCCN(C=CC=C1C(=O)OC(C)(C)OC1=O)CCCCCCCC |
| InChI | InChI=1S/C25H43NO4/c1-5-7-9-11-13-15-19-26(20-16-14-12-10-8-6-2)21-17-18-22-23(27)29-25(3,4)30-24(22)28/h17-18,21H,5-16,19-20H2,1-4H3 |
| InChIKey | HRUBNHVZUAOQMS-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.62 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|