About 5-formyl-4-(3-methylpyridin-1-ium-1-yl)-1,3-thiazol-2-olate
5-formyl-4-(3-methylpyridin-1-ium-1-yl)-1,3-thiazol-2-olate (PubChem CID 767177) has the molecular formula C10H8N2O2S
and a molecular weight of 220.25 g/mol. Its IUPAC name is 5-formyl-4-(3-methylpyridin-1-ium-1-yl)-1,3-thiazol-2-olate.
Molecular Properties
| Compound Name | 5-formyl-4-(3-methylpyridin-1-ium-1-yl)-1,3-thiazol-2-olate |
| PubChem CID | 767177 |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 5-formyl-4-(3-methylpyridin-1-ium-1-yl)-1,3-thiazol-2-olate |
| SMILES | Cc1ccc[n+](-c2nc([O-])sc2C=O)c1 |
| InChI | InChI=1S/C10H8N2O2S/c1-7-3-2-4-12(5-7)9-8(6-13)15-10(14)11-9/h2-6H,1H3 |
| InChIKey | ZDBSHHFSTGSCND-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 56.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-formyl-4-(3-methylpyridin-1-ium-1-yl)-1,3-thiazol-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-formyl-4-(3-methylpyridin-1-ium-1-yl)-1,3-thiazol-2-olate?
The IUPAC name of 5-formyl-4-(3-methylpyridin-1-ium-1-yl)-1,3-thiazol-2-olate (CID 767177) is 5-formyl-4-(3-methylpyridin-1-ium-1-yl)-1,3-thiazol-2-olate.
What is the SMILES notation for 5-formyl-4-(3-methylpyridin-1-ium-1-yl)-1,3-thiazol-2-olate?
The canonical SMILES for 5-formyl-4-(3-methylpyridin-1-ium-1-yl)-1,3-thiazol-2-olate is Cc1ccc[n+](-c2nc([O-])sc2C=O)c1.
What is the InChIKey of 5-formyl-4-(3-methylpyridin-1-ium-1-yl)-1,3-thiazol-2-olate?
The InChIKey is ZDBSHHFSTGSCND-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2S/c1-7-3-2-4-12(5-7)9-8(6-13)15-10(14)11-9/h2-6H,1H3.
What are the key properties of 5-formyl-4-(3-methylpyridin-1-ium-1-yl)-1,3-thiazol-2-olate?
5-formyl-4-(3-methylpyridin-1-ium-1-yl)-1,3-thiazol-2-olate has a molecular weight of 220.25 g/mol, XLogP of 0.61, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-formyl-4-(3-methylpyridin-1-ium-1-yl)-1,3-thiazol-2-olate is sourced from PubChem (CID 767177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).