C21H20N2O5 — CID 7671802
benzyl 2-[3-(2,5-dimethoxyphenyl)-6-oxopyridazin-1-yl]acetate (PubChem CID 7671802) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is benzyl 2-[3-(2,5-dimethoxyphenyl)-6-oxopyridazin-1-yl]acetate.
| Compound Name | benzyl 2-[3-(2,5-dimethoxyphenyl)-6-oxopyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 7671802 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | benzyl 2-[3-(2,5-dimethoxyphenyl)-6-oxopyridazin-1-yl]acetate |
| SMILES | COc1ccc(OC)c(-c2ccc(=O)n(CC(=O)OCc3ccccc3)n2)c1 |
| InChI | InChI=1S/C21H20N2O5/c1-26-16-8-10-19(27-2)17(12-16)18-9-11-20(24)23(22-18)13-21(25)28-14-15-6-4-3-5-7-15/h3-12H,13-14H2,1-2H3 |
| InChIKey | QPIRRRLNTQRYFL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |