C17H20FN7O3 — CID 76722000
3-[[4-(3-fluoropyrrolidin-1-yl)-2-(2-methoxyethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 76722000) has the molecular formula C17H20FN7O3 and a molecular weight of 389.39 g/mol. Its IUPAC name is 3-[[4-(3-fluoropyrrolidin-1-yl)-2-(2-methoxyethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | 3-[[4-(3-fluoropyrrolidin-1-yl)-2-(2-methoxyethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 76722000 |
| Molecular Formula | C17H20FN7O3 |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 3-[[4-(3-fluoropyrrolidin-1-yl)-2-(2-methoxyethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | COCCNc1nc(N2CCC(F)C2)n2ncc(C=C3CC(=O)NC3=O)c2n1 |
| InChI | InChI=1S/C17H20FN7O3/c1-28-5-3-19-16-22-14-11(6-10-7-13(26)21-15(10)27)8-20-25(14)17(23-16)24-4-2-12(18)9-24/h6,8,12H,2-5,7,9H2,1H3,(H,19,22)(H,21,26,27) |
| InChIKey | BGZOYJWGTBOGNB-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|