C29H35ClFN6O6P — CID 76722020
ditert-butyl [3-[[5-(5-chloro-2-fluoroanilino)-7-(cyclopropylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]-2,5-dioxopyrrolidin-1-yl]methyl phosphate (PubChem CID 76722020) has the molecular formula C29H35ClFN6O6P and a molecular weight of 649.06 g/mol. Its IUPAC name is ditert-butyl [3-[[5-(5-chloro-2-fluoroanilino)-7-(cyclopropylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]-2,5-dioxopyrrolidin-1-yl]methyl phosphate.
| Compound Name | ditert-butyl [3-[[5-(5-chloro-2-fluoroanilino)-7-(cyclopropylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]-2,5-dioxopyrrolidin-1-yl]methyl phosphate |
|---|---|
| PubChem CID | 76722020 |
| Molecular Formula | C29H35ClFN6O6P |
| Molecular Weight | 649.06 g/mol |
| Exact Mass | 648.20 |
| IUPAC Name | ditert-butyl [3-[[5-(5-chloro-2-fluoroanilino)-7-(cyclopropylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]-2,5-dioxopyrrolidin-1-yl]methyl phosphate |
| SMILES | CC(C)(C)OP(=O)(OCN1C(=O)CC(=Cc2cnn3c(NC4CC4)cc(Nc4cc(Cl)ccc4F)nc23)C1=O)OC(C)(C)C |
| InChI | InChI=1S/C29H35ClFN6O6P/c1-28(2,3)42-44(40,43-29(4,5)6)41-16-36-25(38)12-17(27(36)39)11-18-15-32-37-24(33-20-8-9-20)14-23(35-26(18)37)34-22-13-19(30)7-10-21(22)31/h7,10-11,13-15,20,33H,8-9,12,16H2,1-6H3,(H,34,35) |
| InChIKey | NFFQLZFXWGSJFD-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 136.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.06 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|