C15H19N7O3 — CID 76722098
3-[[2-(dimethylamino)-4-(2-methoxyethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 76722098) has the molecular formula C15H19N7O3 and a molecular weight of 345.36 g/mol. Its IUPAC name is 3-[[2-(dimethylamino)-4-(2-methoxyethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | 3-[[2-(dimethylamino)-4-(2-methoxyethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 76722098 |
| Molecular Formula | C15H19N7O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 3-[[2-(dimethylamino)-4-(2-methoxyethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | COCCNc1nc(N(C)C)nc2c(C=C3CC(=O)NC3=O)cnn12 |
| InChI | InChI=1S/C15H19N7O3/c1-21(2)15-19-12-10(6-9-7-11(23)18-13(9)24)8-17-22(12)14(20-15)16-4-5-25-3/h6,8H,4-5,7H2,1-3H3,(H,16,19,20)(H,18,23,24) |
| InChIKey | BYUMXRABLIMIAD-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|