C13H15NO2 — CID 76724076
4a,5a,6,7,8,9,9a,10-octahydrobenzo[g]quinoline-2,5-dione (PubChem CID 76724076) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 4a,5a,6,7,8,9,9a,10-octahydrobenzo[g]quinoline-2,5-dione.
| Compound Name | 4a,5a,6,7,8,9,9a,10-octahydrobenzo[g]quinoline-2,5-dione |
|---|---|
| PubChem CID | 76724076 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 4a,5a,6,7,8,9,9a,10-octahydrobenzo[g]quinoline-2,5-dione |
| SMILES | O=C1C=CC2C(=O)C3CCCCC3CC2=N1 |
| InChI | InChI=1S/C13H15NO2/c15-12-6-5-10-11(14-12)7-8-3-1-2-4-9(8)13(10)16/h5-6,8-10H,1-4,7H2 |
| InChIKey | QTXCNEGQQBDTSF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |