C20H16N4O3S — CID 7672559
1-(2,3-dihydroindol-1-yl)-2-[6-(4-nitrophenyl)pyridazin-3-yl]sulfanylethanone (PubChem CID 7672559) has the molecular formula C20H16N4O3S and a molecular weight of 392.44 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-yl)-2-[6-(4-nitrophenyl)pyridazin-3-yl]sulfanylethanone.
| Compound Name | 1-(2,3-dihydroindol-1-yl)-2-[6-(4-nitrophenyl)pyridazin-3-yl]sulfanylethanone |
|---|---|
| PubChem CID | 7672559 |
| Molecular Formula | C20H16N4O3S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 1-(2,3-dihydroindol-1-yl)-2-[6-(4-nitrophenyl)pyridazin-3-yl]sulfanylethanone |
| SMILES | O=C(CSc1ccc(-c2ccc([N+](=O)[O-])cc2)nn1)N1CCc2ccccc21 |
| InChI | InChI=1S/C20H16N4O3S/c25-20(23-12-11-15-3-1-2-4-18(15)23)13-28-19-10-9-17(21-22-19)14-5-7-16(8-6-14)24(26)27/h1-10H,11-13H2 |
| InChIKey | HDEZNQIIKCEZBD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 89.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|