C11H22N4O — CID 76727795
1,3-bis(3-methylbutylideneamino)urea (PubChem CID 76727795) has the molecular formula C11H22N4O and a molecular weight of 226.32 g/mol. Its IUPAC name is 1,3-bis(3-methylbutylideneamino)urea.
| Compound Name | 1,3-bis(3-methylbutylideneamino)urea |
|---|---|
| PubChem CID | 76727795 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 1,3-bis(3-methylbutylideneamino)urea |
| SMILES | CC(C)CC=NNC(=O)NN=CCC(C)C |
| InChI | InChI=1S/C11H22N4O/c1-9(2)5-7-12-14-11(16)15-13-8-6-10(3)4/h7-10H,5-6H2,1-4H3,(H2,14,15,16) |
| InChIKey | VAKKXGLKWWTINT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|