C20H15Cl3O3 — CID 7672809
6-methyl-7-[(2,3,6-trichlorophenyl)methoxy]-2,3-dihydro-1H-cyclopenta[c]chromen-4-one (PubChem CID 7672809) has the molecular formula C20H15Cl3O3 and a molecular weight of 409.70 g/mol. Its IUPAC name is 6-methyl-7-[(2,3,6-trichlorophenyl)methoxy]-2,3-dihydro-1H-cyclopenta[c]chromen-4-one.
| Compound Name | 6-methyl-7-[(2,3,6-trichlorophenyl)methoxy]-2,3-dihydro-1H-cyclopenta[c]chromen-4-one |
|---|---|
| PubChem CID | 7672809 |
| Molecular Formula | C20H15Cl3O3 |
| Molecular Weight | 409.70 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 6-methyl-7-[(2,3,6-trichlorophenyl)methoxy]-2,3-dihydro-1H-cyclopenta[c]chromen-4-one |
| SMILES | Cc1c(OCc2c(Cl)ccc(Cl)c2Cl)ccc2c3c(c(=O)oc12)CCC3 |
| InChI | InChI=1S/C20H15Cl3O3/c1-10-17(25-9-14-15(21)6-7-16(22)18(14)23)8-5-12-11-3-2-4-13(11)20(24)26-19(10)12/h5-8H,2-4,9H2,1H3 |
| InChIKey | PXAHLPASDGKXPG-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.70 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|