C34H43Cl2N3O4 — CID 76730276
3-[[4-[1-[8-tert-butyl-2-(3,5-dichlorophenyl)-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]hexyl]benzoyl]amino]propanoic acid (PubChem CID 76730276) has the molecular formula C34H43Cl2N3O4 and a molecular weight of 628.64 g/mol. Its IUPAC name is 3-[[4-[1-[8-tert-butyl-2-(3,5-dichlorophenyl)-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]hexyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[1-[8-tert-butyl-2-(3,5-dichlorophenyl)-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]hexyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 76730276 |
| Molecular Formula | C34H43Cl2N3O4 |
| Molecular Weight | 628.64 g/mol |
| Exact Mass | 627.26 |
| IUPAC Name | 3-[[4-[1-[8-tert-butyl-2-(3,5-dichlorophenyl)-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]hexyl]benzoyl]amino]propanoic acid |
| SMILES | CCCCCC(c1ccc(C(=O)NCCC(=O)O)cc1)N1C(=O)C(c2cc(Cl)cc(Cl)c2)=NC12CCC(C(C)(C)C)CC2 |
| InChI | InChI=1S/C34H43Cl2N3O4/c1-5-6-7-8-28(22-9-11-23(12-10-22)31(42)37-18-15-29(40)41)39-32(43)30(24-19-26(35)21-27(36)20-24)38-34(39)16-13-25(14-17-34)33(2,3)4/h9-12,19-21,25,28H,5-8,13-18H2,1-4H3,(H,37,42)(H,40,41) |
| InChIKey | CZWMIMRFBFWNAI-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.64 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|