C23H37NO6 — CID 76733289
N-[2-[5-(5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl)-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]-4-hydroxypentanamide (PubChem CID 76733289) has the molecular formula C23H37NO6 and a molecular weight of 423.55 g/mol. Its IUPAC name is N-[2-[5-(5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl)-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]-4-hydroxypentanamide.
| Compound Name | N-[2-[5-(5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl)-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]-4-hydroxypentanamide |
|---|---|
| PubChem CID | 76733289 |
| Molecular Formula | C23H37NO6 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | N-[2-[5-(5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl)-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]-4-hydroxypentanamide |
| SMILES | CC(C=CC1CC2(CO2)CC(C)(C)O1)=CCC1OCC(NC(=O)CCC(C)O)CO1 |
| InChI | InChI=1S/C23H37NO6/c1-16(5-8-19-11-23(15-29-23)14-22(3,4)30-19)6-10-21-27-12-18(13-28-21)24-20(26)9-7-17(2)25/h5-6,8,17-19,21,25H,7,9-15H2,1-4H3,(H,24,26) |
| InChIKey | VTNJHGIIMHTENU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|