About N-cyclopropyl-2-[(3R,4S)-3-ethyl-1-hexanoylpiperidin-4-yl]acetamide
N-cyclopropyl-2-[(3R,4S)-3-ethyl-1-hexanoylpiperidin-4-yl]acetamide (PubChem CID 7673420) has the molecular formula C18H32N2O2
and a molecular weight of 308.47 g/mol. Its IUPAC name is N-cyclopropyl-2-[(3R,4S)-3-ethyl-1-hexanoylpiperidin-4-yl]acetamide.
Molecular Properties
| Compound Name | N-cyclopropyl-2-[(3R,4S)-3-ethyl-1-hexanoylpiperidin-4-yl]acetamide |
| PubChem CID | 7673420 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | N-cyclopropyl-2-[(3R,4S)-3-ethyl-1-hexanoylpiperidin-4-yl]acetamide |
| SMILES | CCCCCC(=O)N1CC[C@@H](CC(=O)NC2CC2)[C@@H](CC)C1 |
| InChI | InChI=1S/C18H32N2O2/c1-3-5-6-7-18(22)20-11-10-15(14(4-2)13-20)12-17(21)19-16-8-9-16/h14-16H,3-13H2,1-2H3,(H,19,21)/t14-,15-/m0/s1 |
| InChIKey | PLRONKIHEHCGDI-GJZGRUSLSA-N |
| XLogP | 3.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopropyl-2-[(3R,4S)-3-ethyl-1-hexanoylpiperidin-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-2-[(3R,4S)-3-ethyl-1-hexanoylpiperidin-4-yl]acetamide?
The IUPAC name of N-cyclopropyl-2-[(3R,4S)-3-ethyl-1-hexanoylpiperidin-4-yl]acetamide (CID 7673420) is N-cyclopropyl-2-[(3R,4S)-3-ethyl-1-hexanoylpiperidin-4-yl]acetamide.
What is the SMILES notation for N-cyclopropyl-2-[(3R,4S)-3-ethyl-1-hexanoylpiperidin-4-yl]acetamide?
The canonical SMILES for N-cyclopropyl-2-[(3R,4S)-3-ethyl-1-hexanoylpiperidin-4-yl]acetamide is CCCCCC(=O)N1CC[C@@H](CC(=O)NC2CC2)[C@@H](CC)C1.
What is the InChIKey of N-cyclopropyl-2-[(3R,4S)-3-ethyl-1-hexanoylpiperidin-4-yl]acetamide?
The InChIKey is PLRONKIHEHCGDI-GJZGRUSLSA-N. The full InChI is InChI=1S/C18H32N2O2/c1-3-5-6-7-18(22)20-11-10-15(14(4-2)13-20)12-17(21)19-16-8-9-16/h14-16H,3-13H2,1-2H3,(H,19,21)/t14-,15-/m0/s1.
What are the key properties of N-cyclopropyl-2-[(3R,4S)-3-ethyl-1-hexanoylpiperidin-4-yl]acetamide?
N-cyclopropyl-2-[(3R,4S)-3-ethyl-1-hexanoylpiperidin-4-yl]acetamide has a molecular weight of 308.47 g/mol, XLogP of 3.11, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-2-[(3R,4S)-3-ethyl-1-hexanoylpiperidin-4-yl]acetamide is sourced from PubChem (CID 7673420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).