C20H36N2O3 — CID 7673421
1-[(3R,4S)-3-ethyl-4-[2-(4-hydroxypiperidin-1-yl)-2-oxoethyl]piperidin-1-yl]hexan-1-one (PubChem CID 7673421) has the molecular formula C20H36N2O3 and a molecular weight of 352.52 g/mol. Its IUPAC name is 1-[(3R,4S)-3-ethyl-4-[2-(4-hydroxypiperidin-1-yl)-2-oxoethyl]piperidin-1-yl]hexan-1-one.
| Compound Name | 1-[(3R,4S)-3-ethyl-4-[2-(4-hydroxypiperidin-1-yl)-2-oxoethyl]piperidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 7673421 |
| Molecular Formula | C20H36N2O3 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.27 |
| IUPAC Name | 1-[(3R,4S)-3-ethyl-4-[2-(4-hydroxypiperidin-1-yl)-2-oxoethyl]piperidin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CC[C@@H](CC(=O)N2CCC(O)CC2)[C@@H](CC)C1 |
| InChI | InChI=1S/C20H36N2O3/c1-3-5-6-7-19(24)22-11-8-17(16(4-2)15-22)14-20(25)21-12-9-18(23)10-13-21/h16-18,23H,3-15H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | BFKCRIYMKKHLRF-IRXDYDNUSA-N |
| XLogP | 2.81 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|