About 2,2-difluoro-8,8-dimethyl-1-propan-2-yloxynon-3-ene
2,2-difluoro-8,8-dimethyl-1-propan-2-yloxynon-3-ene (PubChem CID 76738455) has the molecular formula C14H26F2O
and a molecular weight of 248.36 g/mol. Its IUPAC name is 2,2-difluoro-8,8-dimethyl-1-propan-2-yloxynon-3-ene.
Molecular Properties
| Compound Name | 2,2-difluoro-8,8-dimethyl-1-propan-2-yloxynon-3-ene |
| PubChem CID | 76738455 |
| Molecular Formula | C14H26F2O |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 2,2-difluoro-8,8-dimethyl-1-propan-2-yloxynon-3-ene |
| SMILES | CC(C)OCC(F)(F)C=CCCCC(C)(C)C |
| InChI | InChI=1S/C14H26F2O/c1-12(2)17-11-14(15,16)10-8-6-7-9-13(3,4)5/h8,10,12H,6-7,9,11H2,1-5H3 |
| InChIKey | HWBGDLWVBVZKOJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoro-8,8-dimethyl-1-propan-2-yloxynon-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-8,8-dimethyl-1-propan-2-yloxynon-3-ene?
The IUPAC name of 2,2-difluoro-8,8-dimethyl-1-propan-2-yloxynon-3-ene (CID 76738455) is 2,2-difluoro-8,8-dimethyl-1-propan-2-yloxynon-3-ene.
What is the SMILES notation for 2,2-difluoro-8,8-dimethyl-1-propan-2-yloxynon-3-ene?
The canonical SMILES for 2,2-difluoro-8,8-dimethyl-1-propan-2-yloxynon-3-ene is CC(C)OCC(F)(F)C=CCCCC(C)(C)C.
What is the InChIKey of 2,2-difluoro-8,8-dimethyl-1-propan-2-yloxynon-3-ene?
The InChIKey is HWBGDLWVBVZKOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26F2O/c1-12(2)17-11-14(15,16)10-8-6-7-9-13(3,4)5/h8,10,12H,6-7,9,11H2,1-5H3.
What are the key properties of 2,2-difluoro-8,8-dimethyl-1-propan-2-yloxynon-3-ene?
2,2-difluoro-8,8-dimethyl-1-propan-2-yloxynon-3-ene has a molecular weight of 248.36 g/mol, XLogP of 4.82, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-8,8-dimethyl-1-propan-2-yloxynon-3-ene is sourced from PubChem (CID 76738455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).