C14H26F2O — CID 76738459
6,6-difluoro-2,2,7-trimethyl-1-propan-2-yloxyoct-4-ene (PubChem CID 76738459) has the molecular formula C14H26F2O and a molecular weight of 248.36 g/mol. Its IUPAC name is 6,6-difluoro-2,2,7-trimethyl-1-propan-2-yloxyoct-4-ene.
| Compound Name | 6,6-difluoro-2,2,7-trimethyl-1-propan-2-yloxyoct-4-ene |
|---|---|
| PubChem CID | 76738459 |
| Molecular Formula | C14H26F2O |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 6,6-difluoro-2,2,7-trimethyl-1-propan-2-yloxyoct-4-ene |
| SMILES | CC(C)OCC(C)(C)CC=CC(F)(F)C(C)C |
| InChI | InChI=1S/C14H26F2O/c1-11(2)14(15,16)9-7-8-13(5,6)10-17-12(3)4/h7,9,11-12H,8,10H2,1-6H3 |
| InChIKey | OEAAEDDBLFFYLB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|