C35H41N4O6S+ — CID 76743316
2-[2-[6,9,20-triethyl-7,7,19,19-tetramethyl-17-(sulfomethyl)-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,17,21-nonaen-13-yl]imidazol-1-yl]acetic acid (PubChem CID 76743316) has the molecular formula C35H41N4O6S+ and a molecular weight of 645.80 g/mol. Its IUPAC name is 2-[2-[6,9,20-triethyl-7,7,19,19-tetramethyl-17-(sulfomethyl)-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,17,21-nonaen-13-yl]imidazol-1-yl]acetic acid.
| Compound Name | 2-[2-[6,9,20-triethyl-7,7,19,19-tetramethyl-17-(sulfomethyl)-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,17,21-nonaen-13-yl]imidazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 76743316 |
| Molecular Formula | C35H41N4O6S+ |
| Molecular Weight | 645.80 g/mol |
| Exact Mass | 645.27 |
| IUPAC Name | 2-[2-[6,9,20-triethyl-7,7,19,19-tetramethyl-17-(sulfomethyl)-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,17,21-nonaen-13-yl]imidazol-1-yl]acetic acid |
| SMILES | CCC1=CC(C)(C)[N+](CC)=c2cc3c(cc21)=C(c1nccn1CC(=O)O)c1cc2c(cc1O3)N(CC)C(C)(C)C=C2CS(=O)(=O)O |
| InChI | InChI=1S/C35H40N4O6S/c1-8-21-17-34(4,5)38(9-2)27-15-29-25(13-23(21)27)32(33-36-11-12-37(33)19-31(40)41)26-14-24-22(20-46(42,43)44)18-35(6,7)39(10-3)28(24)16-30(26)45-29/h11-18H,8-10,19-20H2,1-7H3,(H-,40,41,42,43,44)/p+1 |
| InChIKey | JGDRMTXSMXAWRP-UHFFFAOYSA-O |
| XLogP | 4.31 |
| TPSA | 124.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.80 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|