C37H33Cl2FN2O3 — CID 76746721
6-chloro-8'-(3-chloro-2-fluorophenyl)-6'-(2,2-dimethylpropyl)-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-1',2-dione (PubChem CID 76746721) has the molecular formula C37H33Cl2FN2O3 and a molecular weight of 643.59 g/mol. Its IUPAC name is 6-chloro-8'-(3-chloro-2-fluorophenyl)-6'-(2,2-dimethylpropyl)-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-1',2-dione.
| Compound Name | 6-chloro-8'-(3-chloro-2-fluorophenyl)-6'-(2,2-dimethylpropyl)-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-1',2-dione |
|---|---|
| PubChem CID | 76746721 |
| Molecular Formula | C37H33Cl2FN2O3 |
| Molecular Weight | 643.59 g/mol |
| Exact Mass | 642.19 |
| IUPAC Name | 6-chloro-8'-(3-chloro-2-fluorophenyl)-6'-(2,2-dimethylpropyl)-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-1',2-dione |
| SMILES | CC(C)(C)CC1N2C(C(=O)OC(c3ccccc3)C2c2ccccc2)C(c2cccc(Cl)c2F)C12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C37H33Cl2FN2O3/c1-36(2,3)20-28-37(25-18-17-23(38)19-27(25)41-35(37)44)29(24-15-10-16-26(39)30(24)40)32-34(43)45-33(22-13-8-5-9-14-22)31(42(28)32)21-11-6-4-7-12-21/h4-19,28-29,31-33H,20H2,1-3H3,(H,41,44) |
| InChIKey | RPMFQFBFADLWIT-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.59 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |