About (5-hydroxy-2-adamantyl) 3-[[5-(dimethylcarbamoyl)pyrimidin-2-yl]amino]pyrrolidine-1-carboxylate
(5-hydroxy-2-adamantyl) 3-[[5-(dimethylcarbamoyl)pyrimidin-2-yl]amino]pyrrolidine-1-carboxylate (PubChem CID 76747189) has the molecular formula C22H31N5O4
and a molecular weight of 429.52 g/mol. Its IUPAC name is (5-hydroxy-2-adamantyl) 3-[[5-(dimethylcarbamoyl)pyrimidin-2-yl]amino]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | (5-hydroxy-2-adamantyl) 3-[[5-(dimethylcarbamoyl)pyrimidin-2-yl]amino]pyrrolidine-1-carboxylate |
| PubChem CID | 76747189 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | (5-hydroxy-2-adamantyl) 3-[[5-(dimethylcarbamoyl)pyrimidin-2-yl]amino]pyrrolidine-1-carboxylate |
| SMILES | CN(C)C(=O)c1cnc(NC2CCN(C(=O)OC3C4CC5CC3CC(O)(C5)C4)C2)nc1 |
| InChI | InChI=1S/C22H31N5O4/c1-26(2)19(28)16-10-23-20(24-11-16)25-17-3-4-27(12-17)21(29)31-18-14-5-13-6-15(18)9-22(30,7-13)8-14/h10-11,13-15,17-18,30H,3-9,12H2,1-2H3,(H,23,24,25) |
| InChIKey | JGYNGZPDYCUKGQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (5-hydroxy-2-adamantyl) 3-[[5-(dimethylcarbamoyl)pyrimidin-2-yl]amino]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-hydroxy-2-adamantyl) 3-[[5-(dimethylcarbamoyl)pyrimidin-2-yl]amino]pyrrolidine-1-carboxylate?
The IUPAC name of (5-hydroxy-2-adamantyl) 3-[[5-(dimethylcarbamoyl)pyrimidin-2-yl]amino]pyrrolidine-1-carboxylate (CID 76747189) is (5-hydroxy-2-adamantyl) 3-[[5-(dimethylcarbamoyl)pyrimidin-2-yl]amino]pyrrolidine-1-carboxylate.
What is the SMILES notation for (5-hydroxy-2-adamantyl) 3-[[5-(dimethylcarbamoyl)pyrimidin-2-yl]amino]pyrrolidine-1-carboxylate?
The canonical SMILES for (5-hydroxy-2-adamantyl) 3-[[5-(dimethylcarbamoyl)pyrimidin-2-yl]amino]pyrrolidine-1-carboxylate is CN(C)C(=O)c1cnc(NC2CCN(C(=O)OC3C4CC5CC3CC(O)(C5)C4)C2)nc1.
What is the InChIKey of (5-hydroxy-2-adamantyl) 3-[[5-(dimethylcarbamoyl)pyrimidin-2-yl]amino]pyrrolidine-1-carboxylate?
The InChIKey is JGYNGZPDYCUKGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31N5O4/c1-26(2)19(28)16-10-23-20(24-11-16)25-17-3-4-27(12-17)21(29)31-18-14-5-13-6-15(18)9-22(30,7-13)8-14/h10-11,13-15,17-18,30H,3-9,12H2,1-2H3,(H,23,24,25).
What are the key properties of (5-hydroxy-2-adamantyl) 3-[[5-(dimethylcarbamoyl)pyrimidin-2-yl]amino]pyrrolidine-1-carboxylate?
(5-hydroxy-2-adamantyl) 3-[[5-(dimethylcarbamoyl)pyrimidin-2-yl]amino]pyrrolidine-1-carboxylate has a molecular weight of 429.52 g/mol, XLogP of 1.74, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (5-hydroxy-2-adamantyl) 3-[[5-(dimethylcarbamoyl)pyrimidin-2-yl]amino]pyrrolidine-1-carboxylate is sourced from PubChem (CID 76747189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).