About 2-[2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetaldehyde
2-[2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetaldehyde (PubChem CID 76754457) has the molecular formula C18H14ClNO2
and a molecular weight of 311.77 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetaldehyde |
| PubChem CID | 76754457 |
| Molecular Formula | C18H14ClNO2 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetaldehyde |
| SMILES | O=CCN1C(=O)C2(CC2c2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C18H14ClNO2/c19-13-7-5-12(6-8-13)15-11-18(15)14-3-1-2-4-16(14)20(9-10-21)17(18)22/h1-8,10,15H,9,11H2 |
| InChIKey | XURNWOANODJRJH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetaldehyde?
The IUPAC name of 2-[2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetaldehyde (CID 76754457) is 2-[2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetaldehyde.
What is the SMILES notation for 2-[2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetaldehyde?
The canonical SMILES for 2-[2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetaldehyde is O=CCN1C(=O)C2(CC2c2ccc(Cl)cc2)c2ccccc21.
What is the InChIKey of 2-[2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetaldehyde?
The InChIKey is XURNWOANODJRJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14ClNO2/c19-13-7-5-12(6-8-13)15-11-18(15)14-3-1-2-4-16(14)20(9-10-21)17(18)22/h1-8,10,15H,9,11H2.
What are the key properties of 2-[2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetaldehyde?
2-[2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetaldehyde has a molecular weight of 311.77 g/mol, XLogP of 3.31, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetaldehyde is sourced from PubChem (CID 76754457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).