C19H16F3N5O2S — CID 76756873
5-[[2-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 76756873) has the molecular formula C19H16F3N5O2S and a molecular weight of 435.43 g/mol. Its IUPAC name is 5-[[2-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 76756873 |
| Molecular Formula | C19H16F3N5O2S |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 5-[[2-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccnc(N3CCN(c4ccc(C(F)(F)F)cc4)CC3)n2)S1 |
| InChI | InChI=1S/C19H16F3N5O2S/c20-19(21,22)12-1-3-14(4-2-12)26-7-9-27(10-8-26)17-23-6-5-13(24-17)11-15-16(28)25-18(29)30-15/h1-6,11H,7-10H2,(H,25,28,29) |
| InChIKey | DDXRUSJBERPTTJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|