C15H9N3O3 — CID 767585
6-hydroxy-2,8,12-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),3,5,7,13,15,17-heptaene-9,11-dione (PubChem CID 767585) has the molecular formula C15H9N3O3 and a molecular weight of 279.25 g/mol. Its IUPAC name is 6-hydroxy-2,8,12-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),3,5,7,13,15,17-heptaene-9,11-dione.
| Compound Name | 6-hydroxy-2,8,12-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),3,5,7,13,15,17-heptaene-9,11-dione |
|---|---|
| PubChem CID | 767585 |
| Molecular Formula | C15H9N3O3 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 6-hydroxy-2,8,12-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),3,5,7,13,15,17-heptaene-9,11-dione |
| SMILES | O=c1nc2c(O)cccn2c2c1c(=O)[nH]c1ccccc12 |
| InChI | InChI=1S/C15H9N3O3/c19-10-6-3-7-18-12-8-4-1-2-5-9(8)16-14(20)11(12)15(21)17-13(10)18/h1-7,19H,(H,16,20) |
| InChIKey | JVMCRRNTQIVVCR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|