C26H34N6O2 — CID 76760966
4-[(4-amino-1-adamantyl)methylamino]-2-[[2-(2-methoxyethoxy)phenyl]methylamino]pyrimidine-5-carbonitrile (PubChem CID 76760966) has the molecular formula C26H34N6O2 and a molecular weight of 462.60 g/mol. Its IUPAC name is 4-[(4-amino-1-adamantyl)methylamino]-2-[[2-(2-methoxyethoxy)phenyl]methylamino]pyrimidine-5-carbonitrile.
| Compound Name | 4-[(4-amino-1-adamantyl)methylamino]-2-[[2-(2-methoxyethoxy)phenyl]methylamino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 76760966 |
| Molecular Formula | C26H34N6O2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | 4-[(4-amino-1-adamantyl)methylamino]-2-[[2-(2-methoxyethoxy)phenyl]methylamino]pyrimidine-5-carbonitrile |
| SMILES | COCCOc1ccccc1CNc1ncc(C#N)c(NCC23CC4CC(C2)C(N)C(C4)C3)n1 |
| InChI | InChI=1S/C26H34N6O2/c1-33-6-7-34-22-5-3-2-4-18(22)14-29-25-30-15-21(13-27)24(32-25)31-16-26-10-17-8-19(11-26)23(28)20(9-17)12-26/h2-5,15,17,19-20,23H,6-12,14,16,28H2,1H3,(H2,29,30,31,32) |
| InChIKey | LWIABRUEBNGLAU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 118.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|