C31H40N6O2 — CID 76761148
benzyl N-[5-[[[5-cyano-2-(cyclohexylmethylamino)pyrimidin-4-yl]amino]methyl]-2-adamantyl]carbamate (PubChem CID 76761148) has the molecular formula C31H40N6O2 and a molecular weight of 528.70 g/mol. Its IUPAC name is benzyl N-[5-[[[5-cyano-2-(cyclohexylmethylamino)pyrimidin-4-yl]amino]methyl]-2-adamantyl]carbamate.
| Compound Name | benzyl N-[5-[[[5-cyano-2-(cyclohexylmethylamino)pyrimidin-4-yl]amino]methyl]-2-adamantyl]carbamate |
|---|---|
| PubChem CID | 76761148 |
| Molecular Formula | C31H40N6O2 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | benzyl N-[5-[[[5-cyano-2-(cyclohexylmethylamino)pyrimidin-4-yl]amino]methyl]-2-adamantyl]carbamate |
| SMILES | N#Cc1cnc(NCC2CCCCC2)nc1NCC12CC3CC(C1)C(NC(=O)OCc1ccccc1)C(C3)C2 |
| InChI | InChI=1S/C31H40N6O2/c32-16-26-18-34-29(33-17-21-7-3-1-4-8-21)37-28(26)35-20-31-13-23-11-24(14-31)27(25(12-23)15-31)36-30(38)39-19-22-9-5-2-6-10-22/h2,5-6,9-10,18,21,23-25,27H,1,3-4,7-8,11-15,17,19-20H2,(H,36,38)(H2,33,34,35,37) |
| InChIKey | SBAKHYDBUFEDPZ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |