C18H20N4O4S — CID 7676262
ethyl 2-[[2-[[2-(4-methylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]amino]-2-oxoacetyl]amino]acetate (PubChem CID 7676262) has the molecular formula C18H20N4O4S and a molecular weight of 388.45 g/mol. Its IUPAC name is ethyl 2-[[2-[[2-(4-methylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]amino]-2-oxoacetyl]amino]acetate.
| Compound Name | ethyl 2-[[2-[[2-(4-methylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]amino]-2-oxoacetyl]amino]acetate |
|---|---|
| PubChem CID | 7676262 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | ethyl 2-[[2-[[2-(4-methylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]amino]-2-oxoacetyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)C(=O)Nc1c2c(nn1-c1ccc(C)cc1)CSC2 |
| InChI | InChI=1S/C18H20N4O4S/c1-3-26-15(23)8-19-17(24)18(25)20-16-13-9-27-10-14(13)21-22(16)12-6-4-11(2)5-7-12/h4-7H,3,8-10H2,1-2H3,(H,19,24)(H,20,25) |
| InChIKey | YSMPCUPMJRFEID-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|