C14H28I2N2Pt — CID 76763805
diiodoplatinum(2+);(2S,4S)-2,4-dimethylpiperidin-1-ide;(2R,4R)-2,4-dimethylpiperidin-1-ide (PubChem CID 76763805) has the molecular formula C14H28I2N2Pt and a molecular weight of 673.28 g/mol. Its IUPAC name is diiodoplatinum(2+);(2S,4S)-2,4-dimethylpiperidin-1-ide;(2R,4R)-2,4-dimethylpiperidin-1-ide.
| Compound Name | diiodoplatinum(2+);(2S,4S)-2,4-dimethylpiperidin-1-ide;(2R,4R)-2,4-dimethylpiperidin-1-ide |
|---|---|
| PubChem CID | 76763805 |
| Molecular Formula | C14H28I2N2Pt |
| Molecular Weight | 673.28 g/mol |
| Exact Mass | 673.00 |
| IUPAC Name | diiodoplatinum(2+);(2S,4S)-2,4-dimethylpiperidin-1-ide;(2R,4R)-2,4-dimethylpiperidin-1-ide |
| SMILES | C[C@@H]1CC[N-][C@H](C)C1.C[C@H]1CC[N-][C@@H](C)C1.I[Pt+2]I |
| InChI | InChI=1S/2C7H14N.2HI.Pt/c2*1-6-3-4-8-7(2)5-6;;;/h2*6-7H,3-5H2,1-2H3;2*1H;/q2*-1;;;+4/p-2/t2*6-,7-;;;/m10.../s1 |
| InChIKey | GQONVBNTAZAFTH-OHGTWHOJSA-L |
| XLogP | 6.13 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.28 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|