About (2R)-3,3-dimethyl-N-propan-2-yl-1-propan-2-yliminobutan-2-amine
(2R)-3,3-dimethyl-N-propan-2-yl-1-propan-2-yliminobutan-2-amine (PubChem CID 76763881) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is (2R)-3,3-dimethyl-N-propan-2-yl-1-propan-2-yliminobutan-2-amine.
Molecular Properties
| Compound Name | (2R)-3,3-dimethyl-N-propan-2-yl-1-propan-2-yliminobutan-2-amine |
| PubChem CID | 76763881 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | (2R)-3,3-dimethyl-N-propan-2-yl-1-propan-2-yliminobutan-2-amine |
| SMILES | CC(C)/N=C/[C@H](NC(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H26N2/c1-9(2)13-8-11(12(5,6)7)14-10(3)4/h8-11,14H,1-7H3/b13-8+/t11-/m0/s1 |
| InChIKey | WGONBUYJKZFJRV-ZWSXMNCCSA-N |
| XLogP | 2.88 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2R)-3,3-dimethyl-N-propan-2-yl-1-propan-2-yliminobutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3,3-dimethyl-N-propan-2-yl-1-propan-2-yliminobutan-2-amine?
The IUPAC name of (2R)-3,3-dimethyl-N-propan-2-yl-1-propan-2-yliminobutan-2-amine (CID 76763881) is (2R)-3,3-dimethyl-N-propan-2-yl-1-propan-2-yliminobutan-2-amine.
What is the SMILES notation for (2R)-3,3-dimethyl-N-propan-2-yl-1-propan-2-yliminobutan-2-amine?
The canonical SMILES for (2R)-3,3-dimethyl-N-propan-2-yl-1-propan-2-yliminobutan-2-amine is CC(C)/N=C/[C@H](NC(C)C)C(C)(C)C.
What is the InChIKey of (2R)-3,3-dimethyl-N-propan-2-yl-1-propan-2-yliminobutan-2-amine?
The InChIKey is WGONBUYJKZFJRV-ZWSXMNCCSA-N. The full InChI is InChI=1S/C12H26N2/c1-9(2)13-8-11(12(5,6)7)14-10(3)4/h8-11,14H,1-7H3/b13-8+/t11-/m0/s1.
What are the key properties of (2R)-3,3-dimethyl-N-propan-2-yl-1-propan-2-yliminobutan-2-amine?
(2R)-3,3-dimethyl-N-propan-2-yl-1-propan-2-yliminobutan-2-amine has a molecular weight of 198.35 g/mol, XLogP of 2.88, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3,3-dimethyl-N-propan-2-yl-1-propan-2-yliminobutan-2-amine is sourced from PubChem (CID 76763881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).