About 2-[(1S)-1-(butyldiazenyl)ethyl]-1,1-dimethylhydrazine
2-[(1S)-1-(butyldiazenyl)ethyl]-1,1-dimethylhydrazine (PubChem CID 76764084) has the molecular formula C8H20N4
and a molecular weight of 172.28 g/mol. Its IUPAC name is 2-[(1S)-1-(butyldiazenyl)ethyl]-1,1-dimethylhydrazine.
Molecular Properties
| Compound Name | 2-[(1S)-1-(butyldiazenyl)ethyl]-1,1-dimethylhydrazine |
| PubChem CID | 76764084 |
| Molecular Formula | C8H20N4 |
| Molecular Weight | 172.28 g/mol |
| Exact Mass | 172.17 |
| IUPAC Name | 2-[(1S)-1-(butyldiazenyl)ethyl]-1,1-dimethylhydrazine |
| SMILES | CCCC/N=N/[C@@H](C)NN(C)C |
| InChI | InChI=1S/C8H20N4/c1-5-6-7-9-10-8(2)11-12(3)4/h8,11H,5-7H2,1-4H3/b10-9+/t8-/m1/s1 |
| InChIKey | FIDAZQLHWRIURY-KGSKPCQNSA-N |
| XLogP | 1.65 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1S)-1-(butyldiazenyl)ethyl]-1,1-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S)-1-(butyldiazenyl)ethyl]-1,1-dimethylhydrazine?
The IUPAC name of 2-[(1S)-1-(butyldiazenyl)ethyl]-1,1-dimethylhydrazine (CID 76764084) is 2-[(1S)-1-(butyldiazenyl)ethyl]-1,1-dimethylhydrazine.
What is the SMILES notation for 2-[(1S)-1-(butyldiazenyl)ethyl]-1,1-dimethylhydrazine?
The canonical SMILES for 2-[(1S)-1-(butyldiazenyl)ethyl]-1,1-dimethylhydrazine is CCCC/N=N/[C@@H](C)NN(C)C.
What is the InChIKey of 2-[(1S)-1-(butyldiazenyl)ethyl]-1,1-dimethylhydrazine?
The InChIKey is FIDAZQLHWRIURY-KGSKPCQNSA-N. The full InChI is InChI=1S/C8H20N4/c1-5-6-7-9-10-8(2)11-12(3)4/h8,11H,5-7H2,1-4H3/b10-9+/t8-/m1/s1.
What are the key properties of 2-[(1S)-1-(butyldiazenyl)ethyl]-1,1-dimethylhydrazine?
2-[(1S)-1-(butyldiazenyl)ethyl]-1,1-dimethylhydrazine has a molecular weight of 172.28 g/mol, XLogP of 1.65, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S)-1-(butyldiazenyl)ethyl]-1,1-dimethylhydrazine is sourced from PubChem (CID 76764084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).