About 1-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]ethylideneoxidanium
1-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]ethylideneoxidanium (PubChem CID 76764090) has the molecular formula C11H19O+
and a molecular weight of 167.27 g/mol. Its IUPAC name is 1-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]ethylideneoxidanium.
Molecular Properties
| Compound Name | 1-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]ethylideneoxidanium |
| PubChem CID | 76764090 |
| Molecular Formula | C11H19O+ |
| Molecular Weight | 167.27 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 1-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]ethylideneoxidanium |
| SMILES | [H]/[O+]=C(\C)[C@@H]1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C11H18O/c1-8-6-5-7-11(3,4)10(8)9(2)12/h6,10H,5,7H2,1-4H3/p+1/t10-/m0/s1 |
| InChIKey | XFMMYPDDHPSAIH-JTQLQIEISA-O |
| XLogP | 2.93 |
| TPSA | 21.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]ethylideneoxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]ethylideneoxidanium?
The IUPAC name of 1-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]ethylideneoxidanium (CID 76764090) is 1-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]ethylideneoxidanium.
What is the SMILES notation for 1-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]ethylideneoxidanium?
The canonical SMILES for 1-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]ethylideneoxidanium is [H]/[O+]=C(\C)[C@@H]1C(C)=CCCC1(C)C.
What is the InChIKey of 1-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]ethylideneoxidanium?
The InChIKey is XFMMYPDDHPSAIH-JTQLQIEISA-O. The full InChI is InChI=1S/C11H18O/c1-8-6-5-7-11(3,4)10(8)9(2)12/h6,10H,5,7H2,1-4H3/p+1/t10-/m0/s1.
What are the key properties of 1-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]ethylideneoxidanium?
1-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]ethylideneoxidanium has a molecular weight of 167.27 g/mol, XLogP of 2.93, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]ethylideneoxidanium is sourced from PubChem (CID 76764090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).