C12H19NO2 — CID 76764296
(1R)-6,7-dimethoxy-1-methyl-1,2,3,4,5,8-hexahydroisoquinoline (PubChem CID 76764296) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is (1R)-6,7-dimethoxy-1-methyl-1,2,3,4,5,8-hexahydroisoquinoline.
| Compound Name | (1R)-6,7-dimethoxy-1-methyl-1,2,3,4,5,8-hexahydroisoquinoline |
|---|---|
| PubChem CID | 76764296 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (1R)-6,7-dimethoxy-1-methyl-1,2,3,4,5,8-hexahydroisoquinoline |
| SMILES | COC1=C(OC)CC2=C(CCN[C@@H]2C)C1 |
| InChI | InChI=1S/C12H19NO2/c1-8-10-7-12(15-3)11(14-2)6-9(10)4-5-13-8/h8,13H,4-7H2,1-3H3/t8-/m1/s1 |
| InChIKey | OZKNQCKDSJZTPP-MRVPVSSYSA-N |
| XLogP | 1.96 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|