About 4-[[(5S)-5-methyl-1,3-oxazolidin-3-yl]diazenyl]benzonitrile
4-[[(5S)-5-methyl-1,3-oxazolidin-3-yl]diazenyl]benzonitrile (PubChem CID 76764314) has the molecular formula C11H12N4O
and a molecular weight of 216.24 g/mol. Its IUPAC name is 4-[[(5S)-5-methyl-1,3-oxazolidin-3-yl]diazenyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[[(5S)-5-methyl-1,3-oxazolidin-3-yl]diazenyl]benzonitrile |
| PubChem CID | 76764314 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 4-[[(5S)-5-methyl-1,3-oxazolidin-3-yl]diazenyl]benzonitrile |
| SMILES | C[C@H]1CN(/N=N/c2ccc(C#N)cc2)CO1 |
| InChI | InChI=1S/C11H12N4O/c1-9-7-15(8-16-9)14-13-11-4-2-10(6-12)3-5-11/h2-5,9H,7-8H2,1H3/b14-13+/t9-/m0/s1 |
| InChIKey | ABIWXEYFHGWAKY-IIAYEXGSSA-N |
| XLogP | 2.24 |
| TPSA | 60.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(5S)-5-methyl-1,3-oxazolidin-3-yl]diazenyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(5S)-5-methyl-1,3-oxazolidin-3-yl]diazenyl]benzonitrile?
The IUPAC name of 4-[[(5S)-5-methyl-1,3-oxazolidin-3-yl]diazenyl]benzonitrile (CID 76764314) is 4-[[(5S)-5-methyl-1,3-oxazolidin-3-yl]diazenyl]benzonitrile.
What is the SMILES notation for 4-[[(5S)-5-methyl-1,3-oxazolidin-3-yl]diazenyl]benzonitrile?
The canonical SMILES for 4-[[(5S)-5-methyl-1,3-oxazolidin-3-yl]diazenyl]benzonitrile is C[C@H]1CN(/N=N/c2ccc(C#N)cc2)CO1.
What is the InChIKey of 4-[[(5S)-5-methyl-1,3-oxazolidin-3-yl]diazenyl]benzonitrile?
The InChIKey is ABIWXEYFHGWAKY-IIAYEXGSSA-N. The full InChI is InChI=1S/C11H12N4O/c1-9-7-15(8-16-9)14-13-11-4-2-10(6-12)3-5-11/h2-5,9H,7-8H2,1H3/b14-13+/t9-/m0/s1.
What are the key properties of 4-[[(5S)-5-methyl-1,3-oxazolidin-3-yl]diazenyl]benzonitrile?
4-[[(5S)-5-methyl-1,3-oxazolidin-3-yl]diazenyl]benzonitrile has a molecular weight of 216.24 g/mol, XLogP of 2.24, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(5S)-5-methyl-1,3-oxazolidin-3-yl]diazenyl]benzonitrile is sourced from PubChem (CID 76764314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).