C14H16O5 — CID 76764344
ethyl (2Z)-2-[(3R,4Z)-3-methyl-9-oxo-3,6-dihydro-2H-furo[3,4-b]oxocin-7-ylidene]acetate (PubChem CID 76764344) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is ethyl (2Z)-2-[(3R,4Z)-3-methyl-9-oxo-3,6-dihydro-2H-furo[3,4-b]oxocin-7-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-[(3R,4Z)-3-methyl-9-oxo-3,6-dihydro-2H-furo[3,4-b]oxocin-7-ylidene]acetate |
|---|---|
| PubChem CID | 76764344 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | ethyl (2Z)-2-[(3R,4Z)-3-methyl-9-oxo-3,6-dihydro-2H-furo[3,4-b]oxocin-7-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\OC(=O)C2=C1C/C=C\[C@@H](C)CO2 |
| InChI | InChI=1S/C14H16O5/c1-3-17-12(15)7-11-10-6-4-5-9(2)8-18-13(10)14(16)19-11/h4-5,7,9H,3,6,8H2,1-2H3/b5-4-,11-7-/t9-/m1/s1 |
| InChIKey | ROXFPZMDWDMJNI-WVWJFQOCSA-N |
| XLogP | 1.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|