About 2,5-dimethyl-6-phenyl-2,3-dihydro-1H-pyrrolizine
2,5-dimethyl-6-phenyl-2,3-dihydro-1H-pyrrolizine (PubChem CID 76764460) has the molecular formula C15H17N
and a molecular weight of 211.31 g/mol. Its IUPAC name is 2,5-dimethyl-6-phenyl-2,3-dihydro-1H-pyrrolizine.
Molecular Properties
| Compound Name | 2,5-dimethyl-6-phenyl-2,3-dihydro-1H-pyrrolizine |
| PubChem CID | 76764460 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 2,5-dimethyl-6-phenyl-2,3-dihydro-1H-pyrrolizine |
| SMILES | Cc1c(-c2ccccc2)cc2n1CC(C)C2 |
| InChI | InChI=1S/C15H17N/c1-11-8-14-9-15(12(2)16(14)10-11)13-6-4-3-5-7-13/h3-7,9,11H,8,10H2,1-2H3 |
| InChIKey | YDJXHIAOVNFMQW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,5-dimethyl-6-phenyl-2,3-dihydro-1H-pyrrolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-6-phenyl-2,3-dihydro-1H-pyrrolizine?
The IUPAC name of 2,5-dimethyl-6-phenyl-2,3-dihydro-1H-pyrrolizine (CID 76764460) is 2,5-dimethyl-6-phenyl-2,3-dihydro-1H-pyrrolizine.
What is the SMILES notation for 2,5-dimethyl-6-phenyl-2,3-dihydro-1H-pyrrolizine?
The canonical SMILES for 2,5-dimethyl-6-phenyl-2,3-dihydro-1H-pyrrolizine is Cc1c(-c2ccccc2)cc2n1CC(C)C2.
What is the InChIKey of 2,5-dimethyl-6-phenyl-2,3-dihydro-1H-pyrrolizine?
The InChIKey is YDJXHIAOVNFMQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N/c1-11-8-14-9-15(12(2)16(14)10-11)13-6-4-3-5-7-13/h3-7,9,11H,8,10H2,1-2H3.
What are the key properties of 2,5-dimethyl-6-phenyl-2,3-dihydro-1H-pyrrolizine?
2,5-dimethyl-6-phenyl-2,3-dihydro-1H-pyrrolizine has a molecular weight of 211.31 g/mol, XLogP of 3.66, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-6-phenyl-2,3-dihydro-1H-pyrrolizine is sourced from PubChem (CID 76764460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).