About 2-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]phenol
2-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]phenol (PubChem CID 767655) has the molecular formula C14H10N2O3
and a molecular weight of 254.25 g/mol. Its IUPAC name is 2-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]phenol.
Molecular Properties
| Compound Name | 2-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]phenol |
| PubChem CID | 767655 |
| Molecular Formula | C14H10N2O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]phenol |
| SMILES | Oc1ccccc1-c1noc(-c2ccccc2O)n1 |
| InChI | InChI=1S/C14H10N2O3/c17-11-7-3-1-5-9(11)13-15-14(19-16-13)10-6-2-4-8-12(10)18/h1-8,17-18H |
| InChIKey | ICXPUAVXHNLPEO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]phenol?
The IUPAC name of 2-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]phenol (CID 767655) is 2-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]phenol.
What is the SMILES notation for 2-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]phenol?
The canonical SMILES for 2-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]phenol is Oc1ccccc1-c1noc(-c2ccccc2O)n1.
What is the InChIKey of 2-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]phenol?
The InChIKey is ICXPUAVXHNLPEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O3/c17-11-7-3-1-5-9(11)13-15-14(19-16-13)10-6-2-4-8-12(10)18/h1-8,17-18H.
What are the key properties of 2-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]phenol?
2-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]phenol has a molecular weight of 254.25 g/mol, XLogP of 2.81, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]phenol is sourced from PubChem (CID 767655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).