C22H25N2O+ — CID 767684
1-(4-ethoxyphenyl)-2-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-4-ium (PubChem CID 767684) has the molecular formula C22H25N2O+ and a molecular weight of 333.46 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-2-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-4-ium.
| Compound Name | 1-(4-ethoxyphenyl)-2-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-4-ium |
|---|---|
| PubChem CID | 767684 |
| Molecular Formula | C22H25N2O+ |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 1-(4-ethoxyphenyl)-2-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-4-ium |
| SMILES | CCOc1ccc(-n2c(-c3ccccc3)c[n+]3c2CCCCC3)cc1 |
| InChI | InChI=1S/C22H25N2O/c1-2-25-20-14-12-19(13-15-20)24-21(18-9-5-3-6-10-18)17-23-16-8-4-7-11-22(23)24/h3,5-6,9-10,12-15,17H,2,4,7-8,11,16H2,1H3/q+1 |
| InChIKey | VJBSUZOYYIXRIG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|