C23H26ClFN4O2S — CID 76769594
N-[1-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]propylidene]-3-fluoropiperidine-1-sulfonamide (PubChem CID 76769594) has the molecular formula C23H26ClFN4O2S and a molecular weight of 477.01 g/mol. Its IUPAC name is N-[1-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]propylidene]-3-fluoropiperidine-1-sulfonamide.
| Compound Name | N-[1-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]propylidene]-3-fluoropiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 76769594 |
| Molecular Formula | C23H26ClFN4O2S |
| Molecular Weight | 477.01 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | N-[1-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]propylidene]-3-fluoropiperidine-1-sulfonamide |
| SMILES | CCC(=NS(=O)(=O)N1CCCC(F)C1)N1CC(c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C23H26ClFN4O2S/c1-2-22(27-32(30,31)28-14-6-9-20(25)15-28)29-16-21(17-7-4-3-5-8-17)23(26-29)18-10-12-19(24)13-11-18/h3-5,7-8,10-13,20-21H,2,6,9,14-16H2,1H3 |
| InChIKey | QQYQRRLIDKNSBL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.01 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|