About (2,6-dichlorophenyl)methyl quinoxaline-6-carboxylate
(2,6-dichlorophenyl)methyl quinoxaline-6-carboxylate (PubChem CID 7677110) has the molecular formula C16H10Cl2N2O2
and a molecular weight of 333.17 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl quinoxaline-6-carboxylate.
Molecular Properties
| Compound Name | (2,6-dichlorophenyl)methyl quinoxaline-6-carboxylate |
| PubChem CID | 7677110 |
| Molecular Formula | C16H10Cl2N2O2 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | (2,6-dichlorophenyl)methyl quinoxaline-6-carboxylate |
| SMILES | O=C(OCc1c(Cl)cccc1Cl)c1ccc2nccnc2c1 |
| InChI | InChI=1S/C16H10Cl2N2O2/c17-12-2-1-3-13(18)11(12)9-22-16(21)10-4-5-14-15(8-10)20-7-6-19-14/h1-8H,9H2 |
| InChIKey | VWMNVHMTFNYGNY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2,6-dichlorophenyl)methyl quinoxaline-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dichlorophenyl)methyl quinoxaline-6-carboxylate?
The IUPAC name of (2,6-dichlorophenyl)methyl quinoxaline-6-carboxylate (CID 7677110) is (2,6-dichlorophenyl)methyl quinoxaline-6-carboxylate.
What is the SMILES notation for (2,6-dichlorophenyl)methyl quinoxaline-6-carboxylate?
The canonical SMILES for (2,6-dichlorophenyl)methyl quinoxaline-6-carboxylate is O=C(OCc1c(Cl)cccc1Cl)c1ccc2nccnc2c1.
What is the InChIKey of (2,6-dichlorophenyl)methyl quinoxaline-6-carboxylate?
The InChIKey is VWMNVHMTFNYGNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10Cl2N2O2/c17-12-2-1-3-13(18)11(12)9-22-16(21)10-4-5-14-15(8-10)20-7-6-19-14/h1-8H,9H2.
What are the key properties of (2,6-dichlorophenyl)methyl quinoxaline-6-carboxylate?
(2,6-dichlorophenyl)methyl quinoxaline-6-carboxylate has a molecular weight of 333.17 g/mol, XLogP of 4.29, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dichlorophenyl)methyl quinoxaline-6-carboxylate is sourced from PubChem (CID 7677110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).