C19H20ClN5 — CID 76773632
6-chloro-2-[4-(3-methylpiperidin-1-yl)-1,7-naphthyridin-6-yl]pyridin-3-amine (PubChem CID 76773632) has the molecular formula C19H20ClN5 and a molecular weight of 353.86 g/mol. Its IUPAC name is 6-chloro-2-[4-(3-methylpiperidin-1-yl)-1,7-naphthyridin-6-yl]pyridin-3-amine.
| Compound Name | 6-chloro-2-[4-(3-methylpiperidin-1-yl)-1,7-naphthyridin-6-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 76773632 |
| Molecular Formula | C19H20ClN5 |
| Molecular Weight | 353.86 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 6-chloro-2-[4-(3-methylpiperidin-1-yl)-1,7-naphthyridin-6-yl]pyridin-3-amine |
| SMILES | CC1CCCN(c2ccnc3cnc(-c4nc(Cl)ccc4N)cc23)C1 |
| InChI | InChI=1S/C19H20ClN5/c1-12-3-2-8-25(11-12)17-6-7-22-16-10-23-15(9-13(16)17)19-14(21)4-5-18(20)24-19/h4-7,9-10,12H,2-3,8,11,21H2,1H3 |
| InChIKey | HXCUQDFPHQPUCE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.86 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|