C20H26O2 — CID 76773742
15-methoxy-2,6,11-trimethylhexadeca-2,4,6,8,10,12,14-heptaenal (PubChem CID 76773742) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 15-methoxy-2,6,11-trimethylhexadeca-2,4,6,8,10,12,14-heptaenal.
| Compound Name | 15-methoxy-2,6,11-trimethylhexadeca-2,4,6,8,10,12,14-heptaenal |
|---|---|
| PubChem CID | 76773742 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 15-methoxy-2,6,11-trimethylhexadeca-2,4,6,8,10,12,14-heptaenal |
| SMILES | COC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=O |
| InChI | InChI=1S/C20H26O2/c1-17(12-8-14-19(3)16-21)10-6-7-11-18(2)13-9-15-20(4)22-5/h6-16H,1-5H3 |
| InChIKey | NVIUFDDUDATNPI-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|