C31H33ClF2N2O3S — CID 76774676
S-(cyanomethyl) 6-[(3-chlorophenyl)methyl]-12,19-difluoro-11-hydroxy-9,13-dimethyl-16-oxo-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-diene-8-carbothioate (PubChem CID 76774676) has the molecular formula C31H33ClF2N2O3S and a molecular weight of 587.13 g/mol. Its IUPAC name is S-(cyanomethyl) 6-[(3-chlorophenyl)methyl]-12,19-difluoro-11-hydroxy-9,13-dimethyl-16-oxo-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-diene-8-carbothioate.
| Compound Name | S-(cyanomethyl) 6-[(3-chlorophenyl)methyl]-12,19-difluoro-11-hydroxy-9,13-dimethyl-16-oxo-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-diene-8-carbothioate |
|---|---|
| PubChem CID | 76774676 |
| Molecular Formula | C31H33ClF2N2O3S |
| Molecular Weight | 587.13 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | S-(cyanomethyl) 6-[(3-chlorophenyl)methyl]-12,19-difluoro-11-hydroxy-9,13-dimethyl-16-oxo-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-diene-8-carbothioate |
| SMILES | CC12C=CC(=O)C=C1C(F)CC1C3CC4CN(Cc5cccc(Cl)c5)CC4(C(=O)SCC#N)C3(C)CC(O)C12F |
| InChI | InChI=1S/C31H33ClF2N2O3S/c1-28-7-6-21(37)12-24(28)25(33)13-23-22-11-19-16-36(15-18-4-3-5-20(32)10-18)17-30(19,27(39)40-9-8-35)29(22,2)14-26(38)31(23,28)34/h3-7,10,12,19,22-23,25-26,38H,9,11,13-17H2,1-2H3 |
| InChIKey | GMIHTOSIYVCHNV-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.13 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|