C15H14BNO3 — CID 76777789
1-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)-N-phenylmethoxymethanimine (PubChem CID 76777789) has the molecular formula C15H14BNO3 and a molecular weight of 267.09 g/mol. Its IUPAC name is 1-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)-N-phenylmethoxymethanimine.
| Compound Name | 1-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)-N-phenylmethoxymethanimine |
|---|---|
| PubChem CID | 76777789 |
| Molecular Formula | C15H14BNO3 |
| Molecular Weight | 267.09 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 1-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)-N-phenylmethoxymethanimine |
| SMILES | OB1OCc2cccc(C=NOCc3ccccc3)c21 |
| InChI | InChI=1S/C15H14BNO3/c18-16-15-13(7-4-8-14(15)11-19-16)9-17-20-10-12-5-2-1-3-6-12/h1-9,18H,10-11H2 |
| InChIKey | NZVWNRDIIDGCJO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.09 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|